About 4-[(4,5-dimethylpyrazol-1-yl)methyl]-4-ethylheptanoic acid;ethane
4-[(4,5-dimethylpyrazol-1-yl)methyl]-4-ethylheptanoic acid;ethane (PubChem CID 167519820) has the molecular formula C17H32N2O2
and a molecular weight of 296.45 g/mol. Its IUPAC name is 4-[(4,5-dimethylpyrazol-1-yl)methyl]-4-ethylheptanoic acid;ethane.
Molecular Properties
| Compound Name | 4-[(4,5-dimethylpyrazol-1-yl)methyl]-4-ethylheptanoic acid;ethane |
| PubChem CID | 167519820 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 4-[(4,5-dimethylpyrazol-1-yl)methyl]-4-ethylheptanoic acid;ethane |
| SMILES | CC.CCCC(CC)(CCC(=O)O)Cn1ncc(C)c1C |
| InChI | InChI=1S/C15H26N2O2.C2H6/c1-5-8-15(6-2,9-7-14(18)19)11-17-13(4)12(3)10-16-17;1-2/h10H,5-9,11H2,1-4H3,(H,18,19);1-2H3 |
| InChIKey | NGHMUNPWJRIIFL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(4,5-dimethylpyrazol-1-yl)methyl]-4-ethylheptanoic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,5-dimethylpyrazol-1-yl)methyl]-4-ethylheptanoic acid;ethane?
The IUPAC name of 4-[(4,5-dimethylpyrazol-1-yl)methyl]-4-ethylheptanoic acid;ethane (CID 167519820) is 4-[(4,5-dimethylpyrazol-1-yl)methyl]-4-ethylheptanoic acid;ethane.
What is the SMILES notation for 4-[(4,5-dimethylpyrazol-1-yl)methyl]-4-ethylheptanoic acid;ethane?
The canonical SMILES for 4-[(4,5-dimethylpyrazol-1-yl)methyl]-4-ethylheptanoic acid;ethane is CC.CCCC(CC)(CCC(=O)O)Cn1ncc(C)c1C.
What is the InChIKey of 4-[(4,5-dimethylpyrazol-1-yl)methyl]-4-ethylheptanoic acid;ethane?
The InChIKey is NGHMUNPWJRIIFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O2.C2H6/c1-5-8-15(6-2,9-7-14(18)19)11-17-13(4)12(3)10-16-17;1-2/h10H,5-9,11H2,1-4H3,(H,18,19);1-2H3.
What are the key properties of 4-[(4,5-dimethylpyrazol-1-yl)methyl]-4-ethylheptanoic acid;ethane?
4-[(4,5-dimethylpyrazol-1-yl)methyl]-4-ethylheptanoic acid;ethane has a molecular weight of 296.45 g/mol, XLogP of 4.59, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,5-dimethylpyrazol-1-yl)methyl]-4-ethylheptanoic acid;ethane is sourced from PubChem (CID 167519820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).