C33H32N8O2S — CID 167520109
2-[2-(cyclohexylmethyl)-1-methyl-5-oxo-4H-pyrazolo[4,3-f][1,7]naphthyridin-7-yl]-N-([1,3]thiazolo[5,4-b]pyridin-2-yl)-3,4-dihydro-1H-isoquinoline-8-carboxamide (PubChem CID 167520109) has the molecular formula C33H32N8O2S and a molecular weight of 604.74 g/mol. Its IUPAC name is 2-[2-(cyclohexylmethyl)-1-methyl-5-oxo-4H-pyrazolo[4,3-f][1,7]naphthyridin-7-yl]-N-([1,3]thiazolo[5,4-b]pyridin-2-yl)-3,4-dihydro-1H-isoquinoline-8-carboxamide.
| Compound Name | 2-[2-(cyclohexylmethyl)-1-methyl-5-oxo-4H-pyrazolo[4,3-f][1,7]naphthyridin-7-yl]-N-([1,3]thiazolo[5,4-b]pyridin-2-yl)-3,4-dihydro-1H-isoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 167520109 |
| Molecular Formula | C33H32N8O2S |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | 2-[2-(cyclohexylmethyl)-1-methyl-5-oxo-4H-pyrazolo[4,3-f][1,7]naphthyridin-7-yl]-N-([1,3]thiazolo[5,4-b]pyridin-2-yl)-3,4-dihydro-1H-isoquinoline-8-carboxamide |
| SMILES | Cc1c2c(nn1CC1CCCCC1)[nH]c(=O)c1nc(N3CCc4cccc(C(=O)Nc5nc6cccnc6s5)c4C3)ccc12 |
| InChI | InChI=1S/C33H32N8O2S/c1-19-27-23-12-13-26(36-28(23)31(43)37-29(27)39-41(19)17-20-7-3-2-4-8-20)40-16-14-21-9-5-10-22(24(21)18-40)30(42)38-33-35-25-11-6-15-34-32(25)44-33/h5-6,9-13,15,20H,2-4,7-8,14,16-18H2,1H3,(H,35,38,42)(H,37,39,43) |
| InChIKey | USODMSKHKAQLAU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 121.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |