About ethane;4-ethynyl-2,5-dimethyl-2,7-naphthyridin-3-one
ethane;4-ethynyl-2,5-dimethyl-2,7-naphthyridin-3-one (PubChem CID 167521297) has the molecular formula C14H16N2O
and a molecular weight of 228.29 g/mol. Its IUPAC name is ethane;4-ethynyl-2,5-dimethyl-2,7-naphthyridin-3-one.
Molecular Properties
| Compound Name | ethane;4-ethynyl-2,5-dimethyl-2,7-naphthyridin-3-one |
| PubChem CID | 167521297 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | ethane;4-ethynyl-2,5-dimethyl-2,7-naphthyridin-3-one |
| SMILES | C#Cc1c(=O)n(C)cc2cncc(C)c12.CC |
| InChI | InChI=1S/C12H10N2O.C2H6/c1-4-10-11-8(2)5-13-6-9(11)7-14(3)12(10)15;1-2/h1,5-7H,2-3H3;1-2H3 |
| InChIKey | OOXRGIAEXQUNIX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-ethynyl-2,5-dimethyl-2,7-naphthyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethynyl-2,5-dimethyl-2,7-naphthyridin-3-one?
The IUPAC name of ethane;4-ethynyl-2,5-dimethyl-2,7-naphthyridin-3-one (CID 167521297) is ethane;4-ethynyl-2,5-dimethyl-2,7-naphthyridin-3-one.
What is the SMILES notation for ethane;4-ethynyl-2,5-dimethyl-2,7-naphthyridin-3-one?
The canonical SMILES for ethane;4-ethynyl-2,5-dimethyl-2,7-naphthyridin-3-one is C#Cc1c(=O)n(C)cc2cncc(C)c12.CC.
What is the InChIKey of ethane;4-ethynyl-2,5-dimethyl-2,7-naphthyridin-3-one?
The InChIKey is OOXRGIAEXQUNIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O.C2H6/c1-4-10-11-8(2)5-13-6-9(11)7-14(3)12(10)15;1-2/h1,5-7H,2-3H3;1-2H3.
What are the key properties of ethane;4-ethynyl-2,5-dimethyl-2,7-naphthyridin-3-one?
ethane;4-ethynyl-2,5-dimethyl-2,7-naphthyridin-3-one has a molecular weight of 228.29 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethynyl-2,5-dimethyl-2,7-naphthyridin-3-one is sourced from PubChem (CID 167521297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).