C22H37F3N4O3 — CID 167521360
N-[(E)-1-cyano-2-methylbut-2-enyl]formamide;2-methylpropane;2,2,2-trifluoro-N-[2-oxo-2-(3,3,4-trimethylpyrrolidin-1-yl)ethyl]acetamide (PubChem CID 167521360) has the molecular formula C22H37F3N4O3 and a molecular weight of 462.56 g/mol. Its IUPAC name is N-[(E)-1-cyano-2-methylbut-2-enyl]formamide;2-methylpropane;2,2,2-trifluoro-N-[2-oxo-2-(3,3,4-trimethylpyrrolidin-1-yl)ethyl]acetamide.
| Compound Name | N-[(E)-1-cyano-2-methylbut-2-enyl]formamide;2-methylpropane;2,2,2-trifluoro-N-[2-oxo-2-(3,3,4-trimethylpyrrolidin-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 167521360 |
| Molecular Formula | C22H37F3N4O3 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | N-[(E)-1-cyano-2-methylbut-2-enyl]formamide;2-methylpropane;2,2,2-trifluoro-N-[2-oxo-2-(3,3,4-trimethylpyrrolidin-1-yl)ethyl]acetamide |
| SMILES | C/C=C(\C)C(C#N)NC=O.CC(C)C.CC1CN(C(=O)CNC(=O)C(F)(F)F)CC1(C)C |
| InChI | InChI=1S/C11H17F3N2O2.C7H10N2O.C4H10/c1-7-5-16(6-10(7,2)3)8(17)4-15-9(18)11(12,13)14;1-3-6(2)7(4-8)9-5-10;1-4(2)3/h7H,4-6H2,1-3H3,(H,15,18);3,5,7H,1-2H3,(H,9,10);4H,1-3H3/b;6-3+; |
| InChIKey | AWSRQVRZAWDPCD-IYVXQRGSSA-N |
| XLogP | 3.42 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|