C24H23FN6O2S — CID 167521469
N-[4-[[cyano-[4-ethenyl-5-(methylideneamino)-3-pyridinyl]methyl]amino]-3-methyl-4-oxo-1-sulfanylbutyl]-7-fluoro-1H-indole-2-carboxamide (PubChem CID 167521469) has the molecular formula C24H23FN6O2S and a molecular weight of 478.55 g/mol. Its IUPAC name is N-[4-[[cyano-[4-ethenyl-5-(methylideneamino)-3-pyridinyl]methyl]amino]-3-methyl-4-oxo-1-sulfanylbutyl]-7-fluoro-1H-indole-2-carboxamide.
| Compound Name | N-[4-[[cyano-[4-ethenyl-5-(methylideneamino)-3-pyridinyl]methyl]amino]-3-methyl-4-oxo-1-sulfanylbutyl]-7-fluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167521469 |
| Molecular Formula | C24H23FN6O2S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-[4-[[cyano-[4-ethenyl-5-(methylideneamino)-3-pyridinyl]methyl]amino]-3-methyl-4-oxo-1-sulfanylbutyl]-7-fluoro-1H-indole-2-carboxamide |
| SMILES | C=Cc1c(N=C)cncc1C(C#N)NC(=O)C(C)CC(S)NC(=O)c1cc2cccc(F)c2[nH]1 |
| InChI | InChI=1S/C24H23FN6O2S/c1-4-15-16(11-28-12-20(15)27-3)19(10-26)30-23(32)13(2)8-21(34)31-24(33)18-9-14-6-5-7-17(25)22(14)29-18/h4-7,9,11-13,19,21,29,34H,1,3,8H2,2H3,(H,30,32)(H,31,33) |
| InChIKey | QPYQURATHLBDJB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 123.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|