About (3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(1-methylcyclopropyl)oxybutan-1-one;formic acid
(3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(1-methylcyclopropyl)oxybutan-1-one;formic acid (PubChem CID 167521581) has the molecular formula C16H27NO4
and a molecular weight of 297.39 g/mol. Its IUPAC name is (3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(1-methylcyclopropyl)oxybutan-1-one;formic acid.
Molecular Properties
| Compound Name | (3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(1-methylcyclopropyl)oxybutan-1-one;formic acid |
| PubChem CID | 167521581 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | (3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(1-methylcyclopropyl)oxybutan-1-one;formic acid |
| SMILES | C[C@H](CC(=O)N1CC2C(C1)C2(C)C)OC1(C)CC1.O=CO |
| InChI | InChI=1S/C15H25NO2.CH2O2/c1-10(18-15(4)5-6-15)7-13(17)16-8-11-12(9-16)14(11,2)3;2-1-3/h10-12H,5-9H2,1-4H3;1H,(H,2,3)/t10-,11?,12?;/m1./s1 |
| InChIKey | FDMJHVMMJIEYSY-CVEKITNISA-N |
| XLogP | 2.15 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(1-methylcyclopropyl)oxybutan-1-one;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(1-methylcyclopropyl)oxybutan-1-one;formic acid?
The IUPAC name of (3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(1-methylcyclopropyl)oxybutan-1-one;formic acid (CID 167521581) is (3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(1-methylcyclopropyl)oxybutan-1-one;formic acid.
What is the SMILES notation for (3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(1-methylcyclopropyl)oxybutan-1-one;formic acid?
The canonical SMILES for (3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(1-methylcyclopropyl)oxybutan-1-one;formic acid is C[C@H](CC(=O)N1CC2C(C1)C2(C)C)OC1(C)CC1.O=CO.
What is the InChIKey of (3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(1-methylcyclopropyl)oxybutan-1-one;formic acid?
The InChIKey is FDMJHVMMJIEYSY-CVEKITNISA-N. The full InChI is InChI=1S/C15H25NO2.CH2O2/c1-10(18-15(4)5-6-15)7-13(17)16-8-11-12(9-16)14(11,2)3;2-1-3/h10-12H,5-9H2,1-4H3;1H,(H,2,3)/t10-,11?,12?;/m1./s1.
What are the key properties of (3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(1-methylcyclopropyl)oxybutan-1-one;formic acid?
(3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(1-methylcyclopropyl)oxybutan-1-one;formic acid has a molecular weight of 297.39 g/mol, XLogP of 2.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-(1-methylcyclopropyl)oxybutan-1-one;formic acid is sourced from PubChem (CID 167521581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).