C21H26F3N5O4 — CID 167521778
(1R,2S,5S)-N-[cyano(1,2-oxazol-3-yl)methyl]-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 167521778) has the molecular formula C21H26F3N5O4 and a molecular weight of 469.46 g/mol. Its IUPAC name is (1R,2S,5S)-N-[cyano(1,2-oxazol-3-yl)methyl]-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[cyano(1,2-oxazol-3-yl)methyl]-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 167521778 |
| Molecular Formula | C21H26F3N5O4 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (1R,2S,5S)-N-[cyano(1,2-oxazol-3-yl)methyl]-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(C)(C)[C@H](NC(=O)C(F)(F)F)C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NC(C#N)c1ccon1)C2(C)C |
| InChI | InChI=1S/C21H26F3N5O4/c1-19(2,3)15(27-18(32)21(22,23)24)17(31)29-9-10-13(20(10,4)5)14(29)16(30)26-12(8-25)11-6-7-33-28-11/h6-7,10,12-15H,9H2,1-5H3,(H,26,30)(H,27,32)/t10-,12?,13-,14-,15+/m0/s1 |
| InChIKey | SKFXBCIWMLUDPR-PBRQYRHRSA-N |
| XLogP | 1.93 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |