C27H34Cl2F3N5O3 — CID 167521989
N-[cyano-(5,7-dichloroisoquinolin-4-yl)methyl]formamide;2-methylpropane;2,2,2-trifluoro-N-[2-oxo-2-[(4R)-3,3,4-trimethylpyrrolidin-1-yl]ethyl]acetamide (PubChem CID 167521989) has the molecular formula C27H34Cl2F3N5O3 and a molecular weight of 604.50 g/mol. Its IUPAC name is N-[cyano-(5,7-dichloroisoquinolin-4-yl)methyl]formamide;2-methylpropane;2,2,2-trifluoro-N-[2-oxo-2-[(4R)-3,3,4-trimethylpyrrolidin-1-yl]ethyl]acetamide.
| Compound Name | N-[cyano-(5,7-dichloroisoquinolin-4-yl)methyl]formamide;2-methylpropane;2,2,2-trifluoro-N-[2-oxo-2-[(4R)-3,3,4-trimethylpyrrolidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 167521989 |
| Molecular Formula | C27H34Cl2F3N5O3 |
| Molecular Weight | 604.50 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | N-[cyano-(5,7-dichloroisoquinolin-4-yl)methyl]formamide;2-methylpropane;2,2,2-trifluoro-N-[2-oxo-2-[(4R)-3,3,4-trimethylpyrrolidin-1-yl]ethyl]acetamide |
| SMILES | CC(C)C.C[C@H]1CN(C(=O)CNC(=O)C(F)(F)F)CC1(C)C.N#CC(NC=O)c1cncc2cc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C12H7Cl2N3O.C11H17F3N2O2.C4H10/c13-8-1-7-4-16-5-9(11(3-15)17-6-18)12(7)10(14)2-8;1-7-5-16(6-10(7,2)3)8(17)4-15-9(18)11(12,13)14;1-4(2)3/h1-2,4-6,11H,(H,17,18);7H,4-6H2,1-3H3,(H,15,18);4H,1-3H3/t;7-;/m.0./s1 |
| InChIKey | AAMYRPLWMKLIQP-IXSARBFQSA-N |
| XLogP | 5.68 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|