About 3-cyclopropyl-1-methylpyrrolo[2,3-c]pyridine;ethane
3-cyclopropyl-1-methylpyrrolo[2,3-c]pyridine;ethane (PubChem CID 167522006) has the molecular formula C15H24N2
and a molecular weight of 232.37 g/mol. Its IUPAC name is 3-cyclopropyl-1-methylpyrrolo[2,3-c]pyridine;ethane.
Molecular Properties
| Compound Name | 3-cyclopropyl-1-methylpyrrolo[2,3-c]pyridine;ethane |
| PubChem CID | 167522006 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 3-cyclopropyl-1-methylpyrrolo[2,3-c]pyridine;ethane |
| SMILES | CC.CC.Cn1cc(C2CC2)c2ccncc21 |
| InChI | InChI=1S/C11H12N2.2C2H6/c1-13-7-10(8-2-3-8)9-4-5-12-6-11(9)13;2*1-2/h4-8H,2-3H2,1H3;2*1-2H3 |
| InChIKey | WCMBXBQWOYOPNT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopropyl-1-methylpyrrolo[2,3-c]pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-1-methylpyrrolo[2,3-c]pyridine;ethane?
The IUPAC name of 3-cyclopropyl-1-methylpyrrolo[2,3-c]pyridine;ethane (CID 167522006) is 3-cyclopropyl-1-methylpyrrolo[2,3-c]pyridine;ethane.
What is the SMILES notation for 3-cyclopropyl-1-methylpyrrolo[2,3-c]pyridine;ethane?
The canonical SMILES for 3-cyclopropyl-1-methylpyrrolo[2,3-c]pyridine;ethane is CC.CC.Cn1cc(C2CC2)c2ccncc21.
What is the InChIKey of 3-cyclopropyl-1-methylpyrrolo[2,3-c]pyridine;ethane?
The InChIKey is WCMBXBQWOYOPNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2.2C2H6/c1-13-7-10(8-2-3-8)9-4-5-12-6-11(9)13;2*1-2/h4-8H,2-3H2,1H3;2*1-2H3.
What are the key properties of 3-cyclopropyl-1-methylpyrrolo[2,3-c]pyridine;ethane?
3-cyclopropyl-1-methylpyrrolo[2,3-c]pyridine;ethane has a molecular weight of 232.37 g/mol, XLogP of 4.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-1-methylpyrrolo[2,3-c]pyridine;ethane is sourced from PubChem (CID 167522006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).