C22H27NO2Se — CID 16752204
(3aR,4R,6aS)-2,2-dimethyl-5-[(1R)-1-phenylethyl]-4-(phenylselanylmethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole (PubChem CID 16752204) has the molecular formula C22H27NO2Se and a molecular weight of 416.42 g/mol. Its IUPAC name is (3aR,4R,6aS)-2,2-dimethyl-5-[(1R)-1-phenylethyl]-4-(phenylselanylmethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole.
| Compound Name | (3aR,4R,6aS)-2,2-dimethyl-5-[(1R)-1-phenylethyl]-4-(phenylselanylmethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
|---|---|
| PubChem CID | 16752204 |
| Molecular Formula | C22H27NO2Se |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | (3aR,4R,6aS)-2,2-dimethyl-5-[(1R)-1-phenylethyl]-4-(phenylselanylmethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
| SMILES | C[C@H](c1ccccc1)N1C[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1C[Se]c1ccccc1 |
| InChI | InChI=1S/C22H27NO2Se/c1-16(17-10-6-4-7-11-17)23-14-20-21(25-22(2,3)24-20)19(23)15-26-18-12-8-5-9-13-18/h4-13,16,19-21H,14-15H2,1-3H3/t16-,19+,20+,21-/m1/s1 |
| InChIKey | KMJKAHNKJOGALX-MBPVOVBZSA-N |
| XLogP | 3.40 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|