C30H38F3N5O3 — CID 167522111
acetonitrile;(2S)-N-[(5-ethynylisoquinolin-4-yl)methyl]-3,4,4-trimethyl-1-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]pyrrolidine-2-carboxamide;2-methylpropane (PubChem CID 167522111) has the molecular formula C30H38F3N5O3 and a molecular weight of 573.66 g/mol. Its IUPAC name is acetonitrile;(2S)-N-[(5-ethynylisoquinolin-4-yl)methyl]-3,4,4-trimethyl-1-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]pyrrolidine-2-carboxamide;2-methylpropane.
| Compound Name | acetonitrile;(2S)-N-[(5-ethynylisoquinolin-4-yl)methyl]-3,4,4-trimethyl-1-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]pyrrolidine-2-carboxamide;2-methylpropane |
|---|---|
| PubChem CID | 167522111 |
| Molecular Formula | C30H38F3N5O3 |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | acetonitrile;(2S)-N-[(5-ethynylisoquinolin-4-yl)methyl]-3,4,4-trimethyl-1-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]pyrrolidine-2-carboxamide;2-methylpropane |
| SMILES | C#Cc1cccc2cncc(CNC(=O)[C@@H]3C(C)C(C)(C)CN3C(=O)CNC(=O)C(F)(F)F)c12.CC#N.CC(C)C |
| InChI | InChI=1S/C24H25F3N4O3.C4H10.C2H3N/c1-5-15-7-6-8-16-9-28-10-17(19(15)16)11-29-21(33)20-14(2)23(3,4)13-31(20)18(32)12-30-22(34)24(25,26)27;1-4(2)3;1-2-3/h1,6-10,14,20H,11-13H2,2-4H3,(H,29,33)(H,30,34);4H,1-3H3;1H3/t14?,20-;;/m0../s1 |
| InChIKey | ZUDKDHPYOXCILS-DHAIIRAVSA-N |
| XLogP | 4.58 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|