C21H33F3N4O3 — CID 167522166
N-[2-(6-azaspiro[3.4]octan-6-yl)-2-oxoethyl]-2,2,2-trifluoroacetamide;N-(1-cyanobut-3-enyl)formamide;2-methylpropane (PubChem CID 167522166) has the molecular formula C21H33F3N4O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[2-(6-azaspiro[3.4]octan-6-yl)-2-oxoethyl]-2,2,2-trifluoroacetamide;N-(1-cyanobut-3-enyl)formamide;2-methylpropane.
| Compound Name | N-[2-(6-azaspiro[3.4]octan-6-yl)-2-oxoethyl]-2,2,2-trifluoroacetamide;N-(1-cyanobut-3-enyl)formamide;2-methylpropane |
|---|---|
| PubChem CID | 167522166 |
| Molecular Formula | C21H33F3N4O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | N-[2-(6-azaspiro[3.4]octan-6-yl)-2-oxoethyl]-2,2,2-trifluoroacetamide;N-(1-cyanobut-3-enyl)formamide;2-methylpropane |
| SMILES | C=CCC(C#N)NC=O.CC(C)C.O=C(CNC(=O)C(F)(F)F)N1CCC2(CCC2)C1 |
| InChI | InChI=1S/C11H15F3N2O2.C6H8N2O.C4H10/c12-11(13,14)9(18)15-6-8(17)16-5-4-10(7-16)2-1-3-10;1-2-3-6(4-7)8-5-9;1-4(2)3/h1-7H2,(H,15,18);2,5-6H,1,3H2,(H,8,9);4H,1-3H3 |
| InChIKey | KEKAYKBWAVVZRD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|