C28H33F3N6O5 — CID 167522175
N-[cyano-(5-ethynyl-6-methoxy-2,7-naphthyridin-4-yl)methyl]formamide;(3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-methoxybutan-1-one;2,2,2-trifluoroacetamide (PubChem CID 167522175) has the molecular formula C28H33F3N6O5 and a molecular weight of 590.60 g/mol. Its IUPAC name is N-[cyano-(5-ethynyl-6-methoxy-2,7-naphthyridin-4-yl)methyl]formamide;(3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-methoxybutan-1-one;2,2,2-trifluoroacetamide.
| Compound Name | N-[cyano-(5-ethynyl-6-methoxy-2,7-naphthyridin-4-yl)methyl]formamide;(3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-methoxybutan-1-one;2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 167522175 |
| Molecular Formula | C28H33F3N6O5 |
| Molecular Weight | 590.60 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | N-[cyano-(5-ethynyl-6-methoxy-2,7-naphthyridin-4-yl)methyl]formamide;(3R)-1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3-methoxybutan-1-one;2,2,2-trifluoroacetamide |
| SMILES | C#Cc1c(OC)ncc2cncc(C(C#N)NC=O)c12.CO[C@H](C)CC(=O)N1CC2C(C1)C2(C)C.NC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H10N4O2.C12H21NO2.C2H2F3NO/c1-3-10-13-9(6-17-14(10)20-2)5-16-7-11(13)12(4-15)18-8-19;1-8(15-4)5-11(14)13-6-9-10(7-13)12(9,2)3;3-2(4,5)1(6)7/h1,5-8,12H,2H3,(H,18,19);8-10H,5-7H2,1-4H3;(H2,6,7)/t;8-,9?,10?;/m.1./s1 |
| InChIKey | ILYIVTGLUIMHMJ-XNEPYXRZSA-N |
| XLogP | 2.49 |
| TPSA | 160.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.60 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|