C24H30F3N5O3 — CID 167522329
(1R,2S,5S)-N-(1-cyano-1-pyridin-3-ylethyl)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 167522329) has the molecular formula C24H30F3N5O3 and a molecular weight of 493.53 g/mol. Its IUPAC name is (1R,2S,5S)-N-(1-cyano-1-pyridin-3-ylethyl)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-(1-cyano-1-pyridin-3-ylethyl)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 167522329 |
| Molecular Formula | C24H30F3N5O3 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | (1R,2S,5S)-N-(1-cyano-1-pyridin-3-ylethyl)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(C#N)(NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)C2(C)C)c1cccnc1 |
| InChI | InChI=1S/C24H30F3N5O3/c1-21(2,3)17(30-20(35)24(25,26)27)19(34)32-11-14-15(22(14,4)5)16(32)18(33)31-23(6,12-28)13-8-7-9-29-10-13/h7-10,14-17H,11H2,1-6H3,(H,30,35)(H,31,33)/t14-,15-,16-,17+,23?/m0/s1 |
| InChIKey | QNVNDFRFJYPHDC-LHLZACSRSA-N |
| XLogP | 2.51 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |