C20H33F3N4O3 — CID 167522466
N-(1-cyanoprop-2-enyl)formamide;2-methylpropane;2,2,2-trifluoro-N-[2-oxo-2-[(4R)-3,3,4-trimethylpyrrolidin-1-yl]ethyl]acetamide (PubChem CID 167522466) has the molecular formula C20H33F3N4O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-(1-cyanoprop-2-enyl)formamide;2-methylpropane;2,2,2-trifluoro-N-[2-oxo-2-[(4R)-3,3,4-trimethylpyrrolidin-1-yl]ethyl]acetamide.
| Compound Name | N-(1-cyanoprop-2-enyl)formamide;2-methylpropane;2,2,2-trifluoro-N-[2-oxo-2-[(4R)-3,3,4-trimethylpyrrolidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 167522466 |
| Molecular Formula | C20H33F3N4O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | N-(1-cyanoprop-2-enyl)formamide;2-methylpropane;2,2,2-trifluoro-N-[2-oxo-2-[(4R)-3,3,4-trimethylpyrrolidin-1-yl]ethyl]acetamide |
| SMILES | C=CC(C#N)NC=O.CC(C)C.C[C@H]1CN(C(=O)CNC(=O)C(F)(F)F)CC1(C)C |
| InChI | InChI=1S/C11H17F3N2O2.C5H6N2O.C4H10/c1-7-5-16(6-10(7,2)3)8(17)4-15-9(18)11(12,13)14;1-2-5(3-6)7-4-8;1-4(2)3/h7H,4-6H2,1-3H3,(H,15,18);2,4-5H,1H2,(H,7,8);4H,1-3H3/t7-;;/m0../s1 |
| InChIKey | NWYJEDPUKFKLDZ-KLXURFKVSA-N |
| XLogP | 2.64 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|