About 4-[1-(furan-2-yl)-1,4-dioxopentan-2-yl]benzoic acid
4-[1-(furan-2-yl)-1,4-dioxopentan-2-yl]benzoic acid (PubChem CID 16752300) has the molecular formula C16H14O5
and a molecular weight of 286.28 g/mol. Its IUPAC name is 4-[1-(furan-2-yl)-1,4-dioxopentan-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[1-(furan-2-yl)-1,4-dioxopentan-2-yl]benzoic acid |
| PubChem CID | 16752300 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-[1-(furan-2-yl)-1,4-dioxopentan-2-yl]benzoic acid |
| SMILES | CC(=O)CC(C(=O)c1ccco1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H14O5/c1-10(17)9-13(15(18)14-3-2-8-21-14)11-4-6-12(7-5-11)16(19)20/h2-8,13H,9H2,1H3,(H,19,20) |
| InChIKey | GLXDPLAUWAYDBM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1-(furan-2-yl)-1,4-dioxopentan-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(furan-2-yl)-1,4-dioxopentan-2-yl]benzoic acid?
The IUPAC name of 4-[1-(furan-2-yl)-1,4-dioxopentan-2-yl]benzoic acid (CID 16752300) is 4-[1-(furan-2-yl)-1,4-dioxopentan-2-yl]benzoic acid.
What is the SMILES notation for 4-[1-(furan-2-yl)-1,4-dioxopentan-2-yl]benzoic acid?
The canonical SMILES for 4-[1-(furan-2-yl)-1,4-dioxopentan-2-yl]benzoic acid is CC(=O)CC(C(=O)c1ccco1)c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[1-(furan-2-yl)-1,4-dioxopentan-2-yl]benzoic acid?
The InChIKey is GLXDPLAUWAYDBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O5/c1-10(17)9-13(15(18)14-3-2-8-21-14)11-4-6-12(7-5-11)16(19)20/h2-8,13H,9H2,1H3,(H,19,20).
What are the key properties of 4-[1-(furan-2-yl)-1,4-dioxopentan-2-yl]benzoic acid?
4-[1-(furan-2-yl)-1,4-dioxopentan-2-yl]benzoic acid has a molecular weight of 286.28 g/mol, XLogP of 2.92, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(furan-2-yl)-1,4-dioxopentan-2-yl]benzoic acid is sourced from PubChem (CID 16752300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).