About 1-cyclopropyl-4,5-dimethylpyrazole;ethane
1-cyclopropyl-4,5-dimethylpyrazole;ethane (PubChem CID 167523032) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-cyclopropyl-4,5-dimethylpyrazole;ethane.
Molecular Properties
| Compound Name | 1-cyclopropyl-4,5-dimethylpyrazole;ethane |
| PubChem CID | 167523032 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-cyclopropyl-4,5-dimethylpyrazole;ethane |
| SMILES | CC.Cc1cnn(C2CC2)c1C |
| InChI | InChI=1S/C8H12N2.C2H6/c1-6-5-9-10(7(6)2)8-3-4-8;1-2/h5,8H,3-4H2,1-2H3;1-2H3 |
| InChIKey | ISZNCJRBPVZFFS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopropyl-4,5-dimethylpyrazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-4,5-dimethylpyrazole;ethane?
The IUPAC name of 1-cyclopropyl-4,5-dimethylpyrazole;ethane (CID 167523032) is 1-cyclopropyl-4,5-dimethylpyrazole;ethane.
What is the SMILES notation for 1-cyclopropyl-4,5-dimethylpyrazole;ethane?
The canonical SMILES for 1-cyclopropyl-4,5-dimethylpyrazole;ethane is CC.Cc1cnn(C2CC2)c1C.
What is the InChIKey of 1-cyclopropyl-4,5-dimethylpyrazole;ethane?
The InChIKey is ISZNCJRBPVZFFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.C2H6/c1-6-5-9-10(7(6)2)8-3-4-8;1-2/h5,8H,3-4H2,1-2H3;1-2H3.
What are the key properties of 1-cyclopropyl-4,5-dimethylpyrazole;ethane?
1-cyclopropyl-4,5-dimethylpyrazole;ethane has a molecular weight of 166.27 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-4,5-dimethylpyrazole;ethane is sourced from PubChem (CID 167523032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).