C31H39F3N6O5 — CID 167523089
N-[cyano-(5-ethynyl-6-methoxy-2,7-naphthyridin-4-yl)methyl]formamide;(3R)-3-(1-methylcyclopropyl)oxy-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2,2,2-trifluoroacetamide (PubChem CID 167523089) has the molecular formula C31H39F3N6O5 and a molecular weight of 632.68 g/mol. Its IUPAC name is N-[cyano-(5-ethynyl-6-methoxy-2,7-naphthyridin-4-yl)methyl]formamide;(3R)-3-(1-methylcyclopropyl)oxy-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2,2,2-trifluoroacetamide.
| Compound Name | N-[cyano-(5-ethynyl-6-methoxy-2,7-naphthyridin-4-yl)methyl]formamide;(3R)-3-(1-methylcyclopropyl)oxy-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 167523089 |
| Molecular Formula | C31H39F3N6O5 |
| Molecular Weight | 632.68 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | N-[cyano-(5-ethynyl-6-methoxy-2,7-naphthyridin-4-yl)methyl]formamide;(3R)-3-(1-methylcyclopropyl)oxy-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2,2,2-trifluoroacetamide |
| SMILES | C#Cc1c(OC)ncc2cncc(C(C#N)NC=O)c12.CC1CN(C(=O)C[C@@H](C)OC2(C)CC2)CC1(C)C.NC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H27NO2.C14H10N4O2.C2H2F3NO/c1-11-9-16(10-14(11,3)4)13(17)8-12(2)18-15(5)6-7-15;1-3-10-13-9(6-17-14(10)20-2)5-16-7-11(13)12(4-15)18-8-19;3-2(4,5)1(6)7/h11-12H,6-10H2,1-5H3;1,5-8,12H,2H3,(H,18,19);(H2,6,7)/t11?,12-;;/m1../s1 |
| InChIKey | GYIMCBWINCWLJO-GZLBOCEFSA-N |
| XLogP | 3.80 |
| TPSA | 160.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.68 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|