C20H29F3N4O4 — CID 167523104
(1R,2S,5S)-N-(cyanomethyl)-6,6-dimethyl-3-[(2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 167523104) has the molecular formula C20H29F3N4O4 and a molecular weight of 446.47 g/mol. Its IUPAC name is (1R,2S,5S)-N-(cyanomethyl)-6,6-dimethyl-3-[(2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-(cyanomethyl)-6,6-dimethyl-3-[(2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 167523104 |
| Molecular Formula | C20H29F3N4O4 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (1R,2S,5S)-N-(cyanomethyl)-6,6-dimethyl-3-[(2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | C[C@@H](OC(C)(C)C)[C@H](NC(=O)C(F)(F)F)C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NCC#N)C2(C)C |
| InChI | InChI=1S/C20H29F3N4O4/c1-10(31-18(2,3)4)13(26-17(30)20(21,22)23)16(29)27-9-11-12(19(11,5)6)14(27)15(28)25-8-7-24/h10-14H,8-9H2,1-6H3,(H,25,28)(H,26,30)/t10-,11+,12+,13+,14+/m1/s1 |
| InChIKey | QFUCGKUOQBXVGS-QMVSFRDZSA-N |
| XLogP | 1.36 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|