C26H30F4N6O3 — CID 167523323
(5S)-N-[cyano-(7-fluoro-4-methylpyrazolo[1,5-a]pyridin-3-yl)methyl]-3-[3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 167523323) has the molecular formula C26H30F4N6O3 and a molecular weight of 550.56 g/mol. Its IUPAC name is (5S)-N-[cyano-(7-fluoro-4-methylpyrazolo[1,5-a]pyridin-3-yl)methyl]-3-[3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (5S)-N-[cyano-(7-fluoro-4-methylpyrazolo[1,5-a]pyridin-3-yl)methyl]-3-[3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 167523323 |
| Molecular Formula | C26H30F4N6O3 |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | (5S)-N-[cyano-(7-fluoro-4-methylpyrazolo[1,5-a]pyridin-3-yl)methyl]-3-[3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | Cc1ccc(F)n2ncc(C(C#N)NC(=O)C3C4[C@H](CN3C(=O)C(NC(=O)C(F)(F)F)C(C)(C)C)C4(C)C)c12 |
| InChI | InChI=1S/C26H30F4N6O3/c1-12-7-8-16(27)36-18(12)13(10-32-36)15(9-31)33-21(37)19-17-14(25(17,5)6)11-35(19)22(38)20(24(2,3)4)34-23(39)26(28,29)30/h7-8,10,14-15,17,19-20H,11H2,1-6H3,(H,33,37)(H,34,39)/t14-,15?,17?,19?,20?/m0/s1 |
| InChIKey | LMGQRXATXDJUKC-AQIRAGFXSA-N |
| XLogP | 3.04 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|