C22H36N2O+2 — CID 167523451
[(Z,4Z)-4-[4-(3-butylpyridin-1-ium-1-yl)butoxymethylidene]oct-2-enylidene]azanium (PubChem CID 167523451) has the molecular formula C22H36N2O+2 and a molecular weight of 344.54 g/mol. Its IUPAC name is [(Z,4Z)-4-[4-(3-butylpyridin-1-ium-1-yl)butoxymethylidene]oct-2-enylidene]azanium.
| Compound Name | [(Z,4Z)-4-[4-(3-butylpyridin-1-ium-1-yl)butoxymethylidene]oct-2-enylidene]azanium |
|---|---|
| PubChem CID | 167523451 |
| Molecular Formula | C22H36N2O+2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.28 |
| IUPAC Name | [(Z,4Z)-4-[4-(3-butylpyridin-1-ium-1-yl)butoxymethylidene]oct-2-enylidene]azanium |
| SMILES | CCCCC(/C=C\C=[NH2+])=C/OCCCC[n+]1cccc(CCCC)c1 |
| InChI | InChI=1S/C22H35N2O/c1-3-5-11-21-14-10-17-24(19-21)16-7-8-18-25-20-22(12-6-4-2)13-9-15-23/h9-10,13-15,17,19-20,23H,3-8,11-12,16,18H2,1-2H3/q+1/p+1/b13-9-,22-20-,23-15? |
| InChIKey | XCZGDTGPFRVMOX-OEGLQWHOSA-O |
| XLogP | 3.57 |
| TPSA | 38.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|