About CID 167523621
CID 167523621 (PubChem CID 167523621) has the molecular formula C4H4BN2Rb
and a molecular weight of 176.37 g/mol.
Molecular Properties
| Compound Name | CID 167523621 |
| PubChem CID | 167523621 |
| Molecular Formula | C4H4BN2Rb |
| Molecular Weight | 176.37 g/mol |
| Exact Mass | 175.96 |
| IUPAC Name | — |
| SMILES | [B]n1[c-]nc(C)c1.[Rb+] |
| InChI | InChI=1S/C4H4BN2.Rb/c1-4-2-7(5)3-6-4;/h2H,1H3;/q-1;+1 |
| InChIKey | CNQKIBDSUYKMSL-UHFFFAOYSA-N |
| XLogP | -3.07 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.37 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 167523621 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167523621?
The IUPAC name of CID 167523621 (CID 167523621) is not available.
What is the SMILES notation for CID 167523621?
The canonical SMILES for CID 167523621 is [B]n1[c-]nc(C)c1.[Rb+].
What is the InChIKey of CID 167523621?
The InChIKey is CNQKIBDSUYKMSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4BN2.Rb/c1-4-2-7(5)3-6-4;/h2H,1H3;/q-1;+1.
What are the key properties of CID 167523621?
CID 167523621 has a molecular weight of 176.37 g/mol, XLogP of -3.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167523621 is sourced from PubChem (CID 167523621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).