C16H4F11NO2 — CID 167523770
2,2,7-trifluoro-6-(2,3,4,5,6-pentafluorophenyl)-4-(2,2,2-trifluoroethyl)-1,4-benzoxazin-3-one (PubChem CID 167523770) has the molecular formula C16H4F11NO2 and a molecular weight of 451.19 g/mol. Its IUPAC name is 2,2,7-trifluoro-6-(2,3,4,5,6-pentafluorophenyl)-4-(2,2,2-trifluoroethyl)-1,4-benzoxazin-3-one.
| Compound Name | 2,2,7-trifluoro-6-(2,3,4,5,6-pentafluorophenyl)-4-(2,2,2-trifluoroethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 167523770 |
| Molecular Formula | C16H4F11NO2 |
| Molecular Weight | 451.19 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | 2,2,7-trifluoro-6-(2,3,4,5,6-pentafluorophenyl)-4-(2,2,2-trifluoroethyl)-1,4-benzoxazin-3-one |
| SMILES | O=C1N(CC(F)(F)F)c2cc(-c3c(F)c(F)c(F)c(F)c3F)c(F)cc2OC1(F)F |
| InChI | InChI=1S/C16H4F11NO2/c17-5-2-7-6(28(3-15(23,24)25)14(29)16(26,27)30-7)1-4(5)8-9(18)11(20)13(22)12(21)10(8)19/h1-2H,3H2 |
| InChIKey | WIAWCZPFMOCKEH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.19 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|