C19H9F8NO2 — CID 167523772
2,2,7-trifluoro-4-(2-methylbut-3-yn-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,4-benzoxazin-3-one (PubChem CID 167523772) has the molecular formula C19H9F8NO2 and a molecular weight of 435.27 g/mol. Its IUPAC name is 2,2,7-trifluoro-4-(2-methylbut-3-yn-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,4-benzoxazin-3-one.
| Compound Name | 2,2,7-trifluoro-4-(2-methylbut-3-yn-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 167523772 |
| Molecular Formula | C19H9F8NO2 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 2,2,7-trifluoro-4-(2-methylbut-3-yn-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,4-benzoxazin-3-one |
| SMILES | C#CC(C)(C)N1C(=O)C(F)(F)Oc2cc(F)c(-c3c(F)c(F)c(F)c(F)c3F)cc21 |
| InChI | InChI=1S/C19H9F8NO2/c1-4-18(2,3)28-9-5-7(8(20)6-10(9)30-19(26,27)17(28)29)11-12(21)14(23)16(25)15(24)13(11)22/h1,5-6H,2-3H3 |
| InChIKey | BVTVEAUAPDSGQF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|