C10H18N2O5 — CID 167524323
1-[(4aR,6R,7R,8R,8aS)-6-(aminomethyl)-7,8-dihydroxy-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]oxazin-1-yl]ethanone (PubChem CID 167524323) has the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. Its IUPAC name is 1-[(4aR,6R,7R,8R,8aS)-6-(aminomethyl)-7,8-dihydroxy-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]oxazin-1-yl]ethanone.
| Compound Name | 1-[(4aR,6R,7R,8R,8aS)-6-(aminomethyl)-7,8-dihydroxy-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]oxazin-1-yl]ethanone |
|---|---|
| PubChem CID | 167524323 |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-[(4aR,6R,7R,8R,8aS)-6-(aminomethyl)-7,8-dihydroxy-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]oxazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCO[C@@H]2O[C@H](CN)[C@H](O)[C@H](O)[C@@H]21 |
| InChI | InChI=1S/C10H18N2O5/c1-5(13)12-2-3-16-10-7(12)9(15)8(14)6(4-11)17-10/h6-10,14-15H,2-4,11H2,1H3/t6-,7+,8+,9-,10-/m1/s1 |
| InChIKey | RTGUZSIMDROUOT-SOYHJAILSA-N |
| XLogP | -2.36 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |