C10H16N2O6 — CID 167524364
3-[(1S,2R,3R,4R)-1-(aminomethyl)-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]-1,3-oxazolidin-2-one (PubChem CID 167524364) has the molecular formula C10H16N2O6 and a molecular weight of 260.25 g/mol. Its IUPAC name is 3-[(1S,2R,3R,4R)-1-(aminomethyl)-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(1S,2R,3R,4R)-1-(aminomethyl)-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 167524364 |
| Molecular Formula | C10H16N2O6 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 3-[(1S,2R,3R,4R)-1-(aminomethyl)-2,3-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl]-1,3-oxazolidin-2-one |
| SMILES | NC[C@@]12COC(O1)[C@H](N1CCOC1=O)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C10H16N2O6/c11-3-10-4-17-8(18-10)5(6(13)7(10)14)12-1-2-16-9(12)15/h5-8,13-14H,1-4,11H2/t5-,6-,7-,8?,10+/m1/s1 |
| InChIKey | GNXMIHGHEAVZOC-GBKANQOBSA-N |
| XLogP | -2.39 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |