About (1-methylpyrrolidin-1-ium-1-yl)methylsulfonyl-(2,2,2-trifluoroethyl)azanide
(1-methylpyrrolidin-1-ium-1-yl)methylsulfonyl-(2,2,2-trifluoroethyl)azanide (PubChem CID 167524964) has the molecular formula C8H15F3N2O2S
and a molecular weight of 260.28 g/mol. Its IUPAC name is (1-methylpyrrolidin-1-ium-1-yl)methylsulfonyl-(2,2,2-trifluoroethyl)azanide.
Molecular Properties
| Compound Name | (1-methylpyrrolidin-1-ium-1-yl)methylsulfonyl-(2,2,2-trifluoroethyl)azanide |
| PubChem CID | 167524964 |
| Molecular Formula | C8H15F3N2O2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (1-methylpyrrolidin-1-ium-1-yl)methylsulfonyl-(2,2,2-trifluoroethyl)azanide |
| SMILES | C[N+]1(CS(=O)(=O)[N-]CC(F)(F)F)CCCC1 |
| InChI | InChI=1S/C8H15F3N2O2S/c1-13(4-2-3-5-13)7-16(14,15)12-6-8(9,10)11/h2-7H2,1H3 |
| InChIKey | DMTLOHQCXXUJRT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpyrrolidin-1-ium-1-yl)methylsulfonyl-(2,2,2-trifluoroethyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpyrrolidin-1-ium-1-yl)methylsulfonyl-(2,2,2-trifluoroethyl)azanide?
The IUPAC name of (1-methylpyrrolidin-1-ium-1-yl)methylsulfonyl-(2,2,2-trifluoroethyl)azanide (CID 167524964) is (1-methylpyrrolidin-1-ium-1-yl)methylsulfonyl-(2,2,2-trifluoroethyl)azanide.
What is the SMILES notation for (1-methylpyrrolidin-1-ium-1-yl)methylsulfonyl-(2,2,2-trifluoroethyl)azanide?
The canonical SMILES for (1-methylpyrrolidin-1-ium-1-yl)methylsulfonyl-(2,2,2-trifluoroethyl)azanide is C[N+]1(CS(=O)(=O)[N-]CC(F)(F)F)CCCC1.
What is the InChIKey of (1-methylpyrrolidin-1-ium-1-yl)methylsulfonyl-(2,2,2-trifluoroethyl)azanide?
The InChIKey is DMTLOHQCXXUJRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2O2S/c1-13(4-2-3-5-13)7-16(14,15)12-6-8(9,10)11/h2-7H2,1H3.
What are the key properties of (1-methylpyrrolidin-1-ium-1-yl)methylsulfonyl-(2,2,2-trifluoroethyl)azanide?
(1-methylpyrrolidin-1-ium-1-yl)methylsulfonyl-(2,2,2-trifluoroethyl)azanide has a molecular weight of 260.28 g/mol, XLogP of 1.45, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpyrrolidin-1-ium-1-yl)methylsulfonyl-(2,2,2-trifluoroethyl)azanide is sourced from PubChem (CID 167524964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).