C23H16F3N3O4 — CID 167525076
N-[(1R)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-5-(4-fluorophenyl)-N-methyl-1,2-oxazole-3-carboxamide (PubChem CID 167525076) has the molecular formula C23H16F3N3O4 and a molecular weight of 455.39 g/mol. Its IUPAC name is N-[(1R)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-5-(4-fluorophenyl)-N-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(1R)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-5-(4-fluorophenyl)-N-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 167525076 |
| Molecular Formula | C23H16F3N3O4 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-[(1R)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-5-(4-fluorophenyl)-N-methyl-1,2-oxazole-3-carboxamide |
| SMILES | CN(C(=O)c1cc(-c2ccc(F)cc2)on1)[C@H]1COCc2[nH]c(=O)c3cc(F)c(F)cc3c21 |
| InChI | InChI=1S/C23H16F3N3O4/c1-29(23(31)17-8-20(33-28-17)11-2-4-12(24)5-3-11)19-10-32-9-18-21(19)13-6-15(25)16(26)7-14(13)22(30)27-18/h2-8,19H,9-10H2,1H3,(H,27,30)/t19-/m0/s1 |
| InChIKey | OLVUSXYJMDJVAM-IBGZPJMESA-N |
| XLogP | 3.94 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |