C15H20O — CID 167525299
1-(2,6-dimethylcyclohexen-1-yl)-2-methoxybenzene (PubChem CID 167525299) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-(2,6-dimethylcyclohexen-1-yl)-2-methoxybenzene.
| Compound Name | 1-(2,6-dimethylcyclohexen-1-yl)-2-methoxybenzene |
|---|---|
| PubChem CID | 167525299 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1-(2,6-dimethylcyclohexen-1-yl)-2-methoxybenzene |
| SMILES | COc1ccccc1C1=C(C)CCCC1C |
| InChI | InChI=1S/C15H20O/c1-11-7-6-8-12(2)15(11)13-9-4-5-10-14(13)16-3/h4-5,9-11H,6-8H2,1-3H3 |
| InChIKey | CXKVFFWKTUTAFG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |