C11H13ClN4 — CID 167525561
7-chloro-6-(2,2,6,6-tetradeuteriopiperidin-4-yl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 167525561) has the molecular formula C11H13ClN4 and a molecular weight of 240.73 g/mol. Its IUPAC name is 7-chloro-6-(2,2,6,6-tetradeuteriopiperidin-4-yl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 7-chloro-6-(2,2,6,6-tetradeuteriopiperidin-4-yl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 167525561 |
| Molecular Formula | C11H13ClN4 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 7-chloro-6-(2,2,6,6-tetradeuteriopiperidin-4-yl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | [2H]C1([2H])CC(c2cn3ncnc3cc2Cl)CC([2H])([2H])N1 |
| InChI | InChI=1S/C11H13ClN4/c12-10-5-11-14-7-15-16(11)6-9(10)8-1-3-13-4-2-8/h5-8,13H,1-4H2/i3D2,4D2 |
| InChIKey | LQTKWIAVCABFKS-KHORGVISSA-N |
| XLogP | 1.85 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |