C18H12ClNO6 — CID 16752631
2-[(1R)-1-carboxy-2-(4-chlorophenyl)ethyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 16752631) has the molecular formula C18H12ClNO6 and a molecular weight of 373.75 g/mol. Its IUPAC name is 2-[(1R)-1-carboxy-2-(4-chlorophenyl)ethyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[(1R)-1-carboxy-2-(4-chlorophenyl)ethyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 16752631 |
| Molecular Formula | C18H12ClNO6 |
| Molecular Weight | 373.75 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 2-[(1R)-1-carboxy-2-(4-chlorophenyl)ethyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N([C@H](Cc1ccc(Cl)cc1)C(=O)O)C2=O |
| InChI | InChI=1S/C18H12ClNO6/c19-11-4-1-9(2-5-11)7-14(18(25)26)20-15(21)12-6-3-10(17(23)24)8-13(12)16(20)22/h1-6,8,14H,7H2,(H,23,24)(H,25,26)/t14-/m1/s1 |
| InChIKey | DYYXZVQKGQBMRM-CQSZACIVSA-N |
| XLogP | 2.33 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.75 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|