C7H17ClN2 — CID 167526507
(3R,5R)-1,3,5-trimethylpiperazine;hydrochloride (PubChem CID 167526507) has the molecular formula C7H17ClN2 and a molecular weight of 164.68 g/mol. Its IUPAC name is (3R,5R)-1,3,5-trimethylpiperazine;hydrochloride.
| Compound Name | (3R,5R)-1,3,5-trimethylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 167526507 |
| Molecular Formula | C7H17ClN2 |
| Molecular Weight | 164.68 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | (3R,5R)-1,3,5-trimethylpiperazine;hydrochloride |
| SMILES | C[C@@H]1CN(C)C[C@@H](C)N1.Cl |
| InChI | InChI=1S/C7H16N2.ClH/c1-6-4-9(3)5-7(2)8-6;/h6-8H,4-5H2,1-3H3;1H/t6-,7-;/m1./s1 |
| InChIKey | GWGGUTAZAVMFBO-ZJLYAJKPSA-N |
| XLogP | 0.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.68 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |