C8H16Cl3NO2 — CID 167527614
ethyl (2S)-2-amino-5,5-dichloro-2-methylpentanoate;hydrochloride (PubChem CID 167527614) has the molecular formula C8H16Cl3NO2 and a molecular weight of 264.58 g/mol. Its IUPAC name is ethyl (2S)-2-amino-5,5-dichloro-2-methylpentanoate;hydrochloride.
| Compound Name | ethyl (2S)-2-amino-5,5-dichloro-2-methylpentanoate;hydrochloride |
|---|---|
| PubChem CID | 167527614 |
| Molecular Formula | C8H16Cl3NO2 |
| Molecular Weight | 264.58 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | ethyl (2S)-2-amino-5,5-dichloro-2-methylpentanoate;hydrochloride |
| SMILES | CCOC(=O)[C@@](C)(N)CCC(Cl)Cl.Cl |
| InChI | InChI=1S/C8H15Cl2NO2.ClH/c1-3-13-7(12)8(2,11)5-4-6(9)10;/h6H,3-5,11H2,1-2H3;1H/t8-;/m0./s1 |
| InChIKey | LJVYVRMTVDSLEJ-QRPNPIFTSA-N |
| XLogP | 2.27 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.58 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|