About ethyl 3-(3,3-dimethyl-1-oxo-4H-isochromen-4-yl)imidazole-4-carboxylate
ethyl 3-(3,3-dimethyl-1-oxo-4H-isochromen-4-yl)imidazole-4-carboxylate (PubChem CID 16752765) has the molecular formula C17H18N2O4
and a molecular weight of 314.34 g/mol. Its IUPAC name is ethyl 3-(3,3-dimethyl-1-oxo-4H-isochromen-4-yl)imidazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-(3,3-dimethyl-1-oxo-4H-isochromen-4-yl)imidazole-4-carboxylate |
| PubChem CID | 16752765 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | ethyl 3-(3,3-dimethyl-1-oxo-4H-isochromen-4-yl)imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cncn1C1c2ccccc2C(=O)OC1(C)C |
| InChI | InChI=1S/C17H18N2O4/c1-4-22-16(21)13-9-18-10-19(13)14-11-7-5-6-8-12(11)15(20)23-17(14,2)3/h5-10,14H,4H2,1-3H3 |
| InChIKey | RIKRXYKHWAQYAY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-(3,3-dimethyl-1-oxo-4H-isochromen-4-yl)imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(3,3-dimethyl-1-oxo-4H-isochromen-4-yl)imidazole-4-carboxylate?
The IUPAC name of ethyl 3-(3,3-dimethyl-1-oxo-4H-isochromen-4-yl)imidazole-4-carboxylate (CID 16752765) is ethyl 3-(3,3-dimethyl-1-oxo-4H-isochromen-4-yl)imidazole-4-carboxylate.
What is the SMILES notation for ethyl 3-(3,3-dimethyl-1-oxo-4H-isochromen-4-yl)imidazole-4-carboxylate?
The canonical SMILES for ethyl 3-(3,3-dimethyl-1-oxo-4H-isochromen-4-yl)imidazole-4-carboxylate is CCOC(=O)c1cncn1C1c2ccccc2C(=O)OC1(C)C.
What is the InChIKey of ethyl 3-(3,3-dimethyl-1-oxo-4H-isochromen-4-yl)imidazole-4-carboxylate?
The InChIKey is RIKRXYKHWAQYAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O4/c1-4-22-16(21)13-9-18-10-19(13)14-11-7-5-6-8-12(11)15(20)23-17(14,2)3/h5-10,14H,4H2,1-3H3.
What are the key properties of ethyl 3-(3,3-dimethyl-1-oxo-4H-isochromen-4-yl)imidazole-4-carboxylate?
ethyl 3-(3,3-dimethyl-1-oxo-4H-isochromen-4-yl)imidazole-4-carboxylate has a molecular weight of 314.34 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(3,3-dimethyl-1-oxo-4H-isochromen-4-yl)imidazole-4-carboxylate is sourced from PubChem (CID 16752765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).