About [2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 3-methylbutanoate
[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 3-methylbutanoate (PubChem CID 16752776) has the molecular formula C22H28O4
and a molecular weight of 356.46 g/mol. Its IUPAC name is [2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 3-methylbutanoate.
Molecular Properties
| Compound Name | [2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 3-methylbutanoate |
| PubChem CID | 16752776 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 3-methylbutanoate |
| SMILES | Cc1cc(C)c(C2=C(OC(=O)CC(C)C)C3(CCCC3)OC2=O)c(C)c1 |
| InChI | InChI=1S/C22H28O4/c1-13(2)10-17(23)25-20-19(18-15(4)11-14(3)12-16(18)5)21(24)26-22(20)8-6-7-9-22/h11-13H,6-10H2,1-5H3 |
| InChIKey | UEASXBDNBGOPJX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 3-methylbutanoate?
The IUPAC name of [2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 3-methylbutanoate (CID 16752776) is [2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 3-methylbutanoate.
What is the SMILES notation for [2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 3-methylbutanoate?
The canonical SMILES for [2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 3-methylbutanoate is Cc1cc(C)c(C2=C(OC(=O)CC(C)C)C3(CCCC3)OC2=O)c(C)c1.
What is the InChIKey of [2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 3-methylbutanoate?
The InChIKey is UEASXBDNBGOPJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28O4/c1-13(2)10-17(23)25-20-19(18-15(4)11-14(3)12-16(18)5)21(24)26-22(20)8-6-7-9-22/h11-13H,6-10H2,1-5H3.
What are the key properties of [2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 3-methylbutanoate?
[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 3-methylbutanoate has a molecular weight of 356.46 g/mol, XLogP of 4.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 3-methylbutanoate is sourced from PubChem (CID 16752776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).