C18H22ClF2N3O2 — CID 167527852
(4S)-N-[(1S)-1-(3-chloro-2,4-difluorophenyl)-2-cyclohexylethyl]-2-oxoimidazolidine-4-carboxamide (PubChem CID 167527852) has the molecular formula C18H22ClF2N3O2 and a molecular weight of 385.84 g/mol. Its IUPAC name is (4S)-N-[(1S)-1-(3-chloro-2,4-difluorophenyl)-2-cyclohexylethyl]-2-oxoimidazolidine-4-carboxamide.
| Compound Name | (4S)-N-[(1S)-1-(3-chloro-2,4-difluorophenyl)-2-cyclohexylethyl]-2-oxoimidazolidine-4-carboxamide |
|---|---|
| PubChem CID | 167527852 |
| Molecular Formula | C18H22ClF2N3O2 |
| Molecular Weight | 385.84 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | (4S)-N-[(1S)-1-(3-chloro-2,4-difluorophenyl)-2-cyclohexylethyl]-2-oxoimidazolidine-4-carboxamide |
| SMILES | O=C1NC[C@@H](C(=O)N[C@@H](CC2CCCCC2)c2ccc(F)c(Cl)c2F)N1 |
| InChI | InChI=1S/C18H22ClF2N3O2/c19-15-12(20)7-6-11(16(15)21)13(8-10-4-2-1-3-5-10)23-17(25)14-9-22-18(26)24-14/h6-7,10,13-14H,1-5,8-9H2,(H,23,25)(H2,22,24,26)/t13-,14-/m0/s1 |
| InChIKey | KELXLBAQFIYSIK-KBPBESRZSA-N |
| XLogP | 3.43 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.84 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|