C29H30N3OP — CID 16752789
N-[2-[(2S,4R)-2-hydroxy-1-phenyl-3-[(3-phenylphenyl)methyl]-1,3,2-diazaphospholidin-4-yl]ethyl]aniline (PubChem CID 16752789) has the molecular formula C29H30N3OP and a molecular weight of 467.55 g/mol. Its IUPAC name is N-[2-[(2S,4R)-2-hydroxy-1-phenyl-3-[(3-phenylphenyl)methyl]-1,3,2-diazaphospholidin-4-yl]ethyl]aniline.
| Compound Name | N-[2-[(2S,4R)-2-hydroxy-1-phenyl-3-[(3-phenylphenyl)methyl]-1,3,2-diazaphospholidin-4-yl]ethyl]aniline |
|---|---|
| PubChem CID | 16752789 |
| Molecular Formula | C29H30N3OP |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | N-[2-[(2S,4R)-2-hydroxy-1-phenyl-3-[(3-phenylphenyl)methyl]-1,3,2-diazaphospholidin-4-yl]ethyl]aniline |
| SMILES | O[P@]1N(c2ccccc2)C[C@@H](CCNc2ccccc2)N1Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C29H30N3OP/c33-34-31(22-24-11-10-14-26(21-24)25-12-4-1-5-13-25)29(19-20-30-27-15-6-2-7-16-27)23-32(34)28-17-8-3-9-18-28/h1-18,21,29-30,33H,19-20,22-23H2/t29-,34+/m1/s1 |
| InChIKey | VAOZHDJVHGTTGD-SJHOIFEDSA-N |
| XLogP | 6.77 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|