About 4-amino-1-(2-methylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,7-dione
4-amino-1-(2-methylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,7-dione (PubChem CID 167528276) has the molecular formula C14H12N4O2
and a molecular weight of 268.28 g/mol. Its IUPAC name is 4-amino-1-(2-methylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,7-dione.
Molecular Properties
| Compound Name | 4-amino-1-(2-methylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,7-dione |
| PubChem CID | 167528276 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-amino-1-(2-methylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,7-dione |
| SMILES | Cc1ccccc1-n1c(=O)nc(N)c2ccc(=O)[nH]c21 |
| InChI | InChI=1S/C14H12N4O2/c1-8-4-2-3-5-10(8)18-13-9(6-7-11(19)16-13)12(15)17-14(18)20/h2-7H,1H3,(H,16,19)(H2,15,17,20) |
| InChIKey | NLCNUXDDPOTZBV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-1-(2-methylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-(2-methylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,7-dione?
The IUPAC name of 4-amino-1-(2-methylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,7-dione (CID 167528276) is 4-amino-1-(2-methylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,7-dione.
What is the SMILES notation for 4-amino-1-(2-methylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,7-dione?
The canonical SMILES for 4-amino-1-(2-methylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,7-dione is Cc1ccccc1-n1c(=O)nc(N)c2ccc(=O)[nH]c21.
What is the InChIKey of 4-amino-1-(2-methylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,7-dione?
The InChIKey is NLCNUXDDPOTZBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O2/c1-8-4-2-3-5-10(8)18-13-9(6-7-11(19)16-13)12(15)17-14(18)20/h2-7H,1H3,(H,16,19)(H2,15,17,20).
What are the key properties of 4-amino-1-(2-methylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,7-dione?
4-amino-1-(2-methylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,7-dione has a molecular weight of 268.28 g/mol, XLogP of 0.96, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-(2-methylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,7-dione is sourced from PubChem (CID 167528276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).