C21H19F3Si — CID 16752834
triphenyl(3,3,3-trifluoropropyl)silane (PubChem CID 16752834) has the molecular formula C21H19F3Si and a molecular weight of 356.46 g/mol. Its IUPAC name is triphenyl(3,3,3-trifluoropropyl)silane.
| Compound Name | triphenyl(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 16752834 |
| Molecular Formula | C21H19F3Si |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | triphenyl(3,3,3-trifluoropropyl)silane |
| SMILES | FC(F)(F)CC[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19F3Si/c22-21(23,24)16-17-25(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16-17H2 |
| InChIKey | HCWALEHDXLABRL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|