About 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(2-methoxyphenyl)iminomethyl]benzoate hexafluorophosphate
2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(2-methoxyphenyl)iminomethyl]benzoate hexafluorophosphate (PubChem CID 16752873) has the molecular formula C21H22F6N3O3P
and a molecular weight of 509.39 g/mol. Its IUPAC name is 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(2-methoxyphenyl)iminomethyl]benzoate hexafluorophosphate.
Molecular Properties
| Compound Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(2-methoxyphenyl)iminomethyl]benzoate hexafluorophosphate |
| PubChem CID | 16752873 |
| Molecular Formula | C21H22F6N3O3P |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(2-methoxyphenyl)iminomethyl]benzoate hexafluorophosphate |
| SMILES | COc1ccccc1/N=C/c1ccc(C(=O)OCCn2cc[n+](C)c2)cc1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C21H22N3O3.F6P/c1-23-11-12-24(16-23)13-14-27-21(25)18-9-7-17(8-10-18)15-22-19-5-3-4-6-20(19)26-2;1-7(2,3,4,5)6/h3-12,15-16H,13-14H2,1-2H3;/q+1;-1/b22-15+; |
| InChIKey | ORCYBLHIYAHBFM-WXXHTBLMSA-N |
| XLogP | 6.31 |
| TPSA | 56.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(2-methoxyphenyl)iminomethyl]benzoate hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(2-methoxyphenyl)iminomethyl]benzoate hexafluorophosphate?
The IUPAC name of 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(2-methoxyphenyl)iminomethyl]benzoate hexafluorophosphate (CID 16752873) is 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(2-methoxyphenyl)iminomethyl]benzoate hexafluorophosphate.
What is the SMILES notation for 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(2-methoxyphenyl)iminomethyl]benzoate hexafluorophosphate?
The canonical SMILES for 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(2-methoxyphenyl)iminomethyl]benzoate hexafluorophosphate is COc1ccccc1/N=C/c1ccc(C(=O)OCCn2cc[n+](C)c2)cc1.F[P-](F)(F)(F)(F)F.
What is the InChIKey of 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(2-methoxyphenyl)iminomethyl]benzoate hexafluorophosphate?
The InChIKey is ORCYBLHIYAHBFM-WXXHTBLMSA-N. The full InChI is InChI=1S/C21H22N3O3.F6P/c1-23-11-12-24(16-23)13-14-27-21(25)18-9-7-17(8-10-18)15-22-19-5-3-4-6-20(19)26-2;1-7(2,3,4,5)6/h3-12,15-16H,13-14H2,1-2H3;/q+1;-1/b22-15+;.
What are the key properties of 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(2-methoxyphenyl)iminomethyl]benzoate hexafluorophosphate?
2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(2-methoxyphenyl)iminomethyl]benzoate hexafluorophosphate has a molecular weight of 509.39 g/mol, XLogP of 6.31, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylimidazol-3-ium-1-yl)ethyl 4-[(2-methoxyphenyl)iminomethyl]benzoate hexafluorophosphate is sourced from PubChem (CID 16752873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).