About 5-(1,2-oxazolidin-3-yl)-1H-pyridin-2-one;hydrochloride
5-(1,2-oxazolidin-3-yl)-1H-pyridin-2-one;hydrochloride (PubChem CID 167528758) has the molecular formula C8H11ClN2O2
and a molecular weight of 202.64 g/mol. Its IUPAC name is 5-(1,2-oxazolidin-3-yl)-1H-pyridin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 5-(1,2-oxazolidin-3-yl)-1H-pyridin-2-one;hydrochloride |
| PubChem CID | 167528758 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 5-(1,2-oxazolidin-3-yl)-1H-pyridin-2-one;hydrochloride |
| SMILES | Cl.O=c1ccc(C2CCON2)c[nH]1 |
| InChI | InChI=1S/C8H10N2O2.ClH/c11-8-2-1-6(5-9-8)7-3-4-12-10-7;/h1-2,5,7,10H,3-4H2,(H,9,11);1H |
| InChIKey | NOOOPHVYFZGDTN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(1,2-oxazolidin-3-yl)-1H-pyridin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,2-oxazolidin-3-yl)-1H-pyridin-2-one;hydrochloride?
The IUPAC name of 5-(1,2-oxazolidin-3-yl)-1H-pyridin-2-one;hydrochloride (CID 167528758) is 5-(1,2-oxazolidin-3-yl)-1H-pyridin-2-one;hydrochloride.
What is the SMILES notation for 5-(1,2-oxazolidin-3-yl)-1H-pyridin-2-one;hydrochloride?
The canonical SMILES for 5-(1,2-oxazolidin-3-yl)-1H-pyridin-2-one;hydrochloride is Cl.O=c1ccc(C2CCON2)c[nH]1.
What is the InChIKey of 5-(1,2-oxazolidin-3-yl)-1H-pyridin-2-one;hydrochloride?
The InChIKey is NOOOPHVYFZGDTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2.ClH/c11-8-2-1-6(5-9-8)7-3-4-12-10-7;/h1-2,5,7,10H,3-4H2,(H,9,11);1H.
What are the key properties of 5-(1,2-oxazolidin-3-yl)-1H-pyridin-2-one;hydrochloride?
5-(1,2-oxazolidin-3-yl)-1H-pyridin-2-one;hydrochloride has a molecular weight of 202.64 g/mol, XLogP of 0.76, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2-oxazolidin-3-yl)-1H-pyridin-2-one;hydrochloride is sourced from PubChem (CID 167528758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).