C22H31NO7 — CID 16752925
[(3R)-2-benzyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidin-5-yl]methanol (PubChem CID 16752925) has the molecular formula C22H31NO7 and a molecular weight of 421.49 g/mol. Its IUPAC name is [(3R)-2-benzyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidin-5-yl]methanol.
| Compound Name | [(3R)-2-benzyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidin-5-yl]methanol |
|---|---|
| PubChem CID | 16752925 |
| Molecular Formula | C22H31NO7 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | [(3R)-2-benzyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidin-5-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1OC(C)(C)O[C@H]1O[C@@H]2[C@H]1CC(CO)ON1Cc1ccccc1 |
| InChI | InChI=1S/C22H31NO7/c1-21(2)26-17-16(25-20-19(18(17)27-21)28-22(3,4)29-20)15-10-14(12-24)30-23(15)11-13-8-6-5-7-9-13/h5-9,14-20,24H,10-12H2,1-4H3/t14?,15-,16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | ZUJQCFXKCOOQDW-MXHUQLJLSA-N |
| XLogP | 1.95 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |