C24H14BrNO — CID 167529339
2-(4-bromophenyl)-4-phenylindeno[1,2-b]pyridin-5-one (PubChem CID 167529339) has the molecular formula C24H14BrNO and a molecular weight of 412.29 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-phenylindeno[1,2-b]pyridin-5-one.
| Compound Name | 2-(4-bromophenyl)-4-phenylindeno[1,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 167529339 |
| Molecular Formula | C24H14BrNO |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 2-(4-bromophenyl)-4-phenylindeno[1,2-b]pyridin-5-one |
| SMILES | O=C1c2ccccc2-c2nc(-c3ccc(Br)cc3)cc(-c3ccccc3)c21 |
| InChI | InChI=1S/C24H14BrNO/c25-17-12-10-16(11-13-17)21-14-20(15-6-2-1-3-7-15)22-23(26-21)18-8-4-5-9-19(18)24(22)27/h1-14H |
| InChIKey | WIBKDOPILSRPGE-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|