C17H19BBrNO2 — CID 167529988
2-[4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine (PubChem CID 167529988) has the molecular formula C17H19BBrNO2 and a molecular weight of 360.06 g/mol. Its IUPAC name is 2-[4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine.
| Compound Name | 2-[4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 167529988 |
| Molecular Formula | C17H19BBrNO2 |
| Molecular Weight | 360.06 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-[4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
| SMILES | CC1(C)OB(c2cc(Br)ccc2-c2ccccn2)OC1(C)C |
| InChI | InChI=1S/C17H19BBrNO2/c1-16(2)17(3,4)22-18(21-16)14-11-12(19)8-9-13(14)15-7-5-6-10-20-15/h5-11H,1-4H3 |
| InChIKey | NNUTUVDCQCLTFB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.06 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|