About thiazologermole
thiazologermole (PubChem CID 167530643) has the molecular formula C5H4GeNS
and a molecular weight of 182.77 g/mol.
Molecular Properties
| Compound Name | thiazologermole |
| PubChem CID | 167530643 |
| Molecular Formula | C5H4GeNS |
| Molecular Weight | 182.77 g/mol |
| Exact Mass | 183.93 |
| IUPAC Name | — |
| SMILES | C1=CC2=NCSC2=[Ge]1 |
| InChI | InChI=1S/C5H4GeNS/c1-2-6-5-4(1)7-3-8-5/h1-2H,3H2 |
| InChIKey | HQAVYNPTTQSUCG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.77 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze thiazologermole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiazologermole?
The IUPAC name of thiazologermole (CID 167530643) is not available.
What is the SMILES notation for thiazologermole?
The canonical SMILES for thiazologermole is C1=CC2=NCSC2=[Ge]1.
What is the InChIKey of thiazologermole?
The InChIKey is HQAVYNPTTQSUCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4GeNS/c1-2-6-5-4(1)7-3-8-5/h1-2H,3H2.
What are the key properties of thiazologermole?
thiazologermole has a molecular weight of 182.77 g/mol, XLogP of 0.49, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thiazologermole is sourced from PubChem (CID 167530643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).