C15H20N6S — CID 167531223
N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 167531223) has the molecular formula C15H20N6S and a molecular weight of 316.43 g/mol. Its IUPAC name is N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 167531223 |
| Molecular Formula | C15H20N6S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N,N-bis[(3,5-dimethylpyrazol-1-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | Cc1cc(C)n(CN(Cn2nc(C)cc2C)c2nccs2)n1 |
| InChI | InChI=1S/C15H20N6S/c1-11-7-13(3)20(17-11)9-19(15-16-5-6-22-15)10-21-14(4)8-12(2)18-21/h5-8H,9-10H2,1-4H3 |
| InChIKey | YOYGBQSIVLDLDQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |