C38H26ClF17Ge — CID 16753130
(4-chlorophenyl)-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-bis(naphthalen-2-ylmethyl)germane (PubChem CID 16753130) has the molecular formula C38H26ClF17Ge and a molecular weight of 913.65 g/mol. Its IUPAC name is (4-chlorophenyl)-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-bis(naphthalen-2-ylmethyl)germane.
| Compound Name | (4-chlorophenyl)-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-bis(naphthalen-2-ylmethyl)germane |
|---|---|
| PubChem CID | 16753130 |
| Molecular Formula | C38H26ClF17Ge |
| Molecular Weight | 913.65 g/mol |
| Exact Mass | 914.07 |
| IUPAC Name | (4-chlorophenyl)-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-bis(naphthalen-2-ylmethyl)germane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Ge](Cc1ccc2ccccc2c1)(Cc1ccc2ccccc2c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C38H26ClF17Ge/c39-29-13-15-30(16-14-29)57(21-23-9-11-25-5-1-3-7-27(25)19-23,22-24-10-12-26-6-2-4-8-28(26)20-24)18-17-31(40,41)32(42,43)33(44,45)34(46,47)35(48,49)36(50,51)37(52,53)38(54,55)56/h1-16,19-20H,17-18,21-22H2 |
| InChIKey | CWYDPYOKIZKHOV-UHFFFAOYSA-N |
| XLogP | 13.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.65 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|