About 2-[6-(4-bromophenyl)-1,2,4,5-tetrazin-3-yl]ethanol
2-[6-(4-bromophenyl)-1,2,4,5-tetrazin-3-yl]ethanol (PubChem CID 167531341) has the molecular formula C10H9BrN4O
and a molecular weight of 281.11 g/mol. Its IUPAC name is 2-[6-(4-bromophenyl)-1,2,4,5-tetrazin-3-yl]ethanol.
Molecular Properties
| Compound Name | 2-[6-(4-bromophenyl)-1,2,4,5-tetrazin-3-yl]ethanol |
| PubChem CID | 167531341 |
| Molecular Formula | C10H9BrN4O |
| Molecular Weight | 281.11 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 2-[6-(4-bromophenyl)-1,2,4,5-tetrazin-3-yl]ethanol |
| SMILES | OCCc1nnc(-c2ccc(Br)cc2)nn1 |
| InChI | InChI=1S/C10H9BrN4O/c11-8-3-1-7(2-4-8)10-14-12-9(5-6-16)13-15-10/h1-4,16H,5-6H2 |
| InChIKey | DPRSOJMFCJJWKU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.11 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[6-(4-bromophenyl)-1,2,4,5-tetrazin-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(4-bromophenyl)-1,2,4,5-tetrazin-3-yl]ethanol?
The IUPAC name of 2-[6-(4-bromophenyl)-1,2,4,5-tetrazin-3-yl]ethanol (CID 167531341) is 2-[6-(4-bromophenyl)-1,2,4,5-tetrazin-3-yl]ethanol.
What is the SMILES notation for 2-[6-(4-bromophenyl)-1,2,4,5-tetrazin-3-yl]ethanol?
The canonical SMILES for 2-[6-(4-bromophenyl)-1,2,4,5-tetrazin-3-yl]ethanol is OCCc1nnc(-c2ccc(Br)cc2)nn1.
What is the InChIKey of 2-[6-(4-bromophenyl)-1,2,4,5-tetrazin-3-yl]ethanol?
The InChIKey is DPRSOJMFCJJWKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN4O/c11-8-3-1-7(2-4-8)10-14-12-9(5-6-16)13-15-10/h1-4,16H,5-6H2.
What are the key properties of 2-[6-(4-bromophenyl)-1,2,4,5-tetrazin-3-yl]ethanol?
2-[6-(4-bromophenyl)-1,2,4,5-tetrazin-3-yl]ethanol has a molecular weight of 281.11 g/mol, XLogP of 1.23, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(4-bromophenyl)-1,2,4,5-tetrazin-3-yl]ethanol is sourced from PubChem (CID 167531341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).