C30H33N3O3 — CID 16753151
(4S,5R)-4-[(1S)-1-azido-2-trityloxyethyl]-5-but-3-enyl-2,2-dimethyl-1,3-dioxolane (PubChem CID 16753151) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is (4S,5R)-4-[(1S)-1-azido-2-trityloxyethyl]-5-but-3-enyl-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5R)-4-[(1S)-1-azido-2-trityloxyethyl]-5-but-3-enyl-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 16753151 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | (4S,5R)-4-[(1S)-1-azido-2-trityloxyethyl]-5-but-3-enyl-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=CCC[C@H]1OC(C)(C)O[C@H]1[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)N=[N+]=[N-] |
| InChI | InChI=1S/C30H33N3O3/c1-4-5-21-27-28(36-29(2,3)35-27)26(32-33-31)22-34-30(23-15-9-6-10-16-23,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h4,6-20,26-28H,1,5,21-22H2,2-3H3/t26-,27+,28-/m0/s1 |
| InChIKey | QEUWITJHZFIZTP-IARZGTGTSA-N |
| XLogP | 7.16 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|