C12H10F2N2O4 — CID 167531667
1-[4-(2,5-dioxopyrrol-1-yl)-3,3-difluorobutyl]pyrrole-2,5-dione (PubChem CID 167531667) has the molecular formula C12H10F2N2O4 and a molecular weight of 284.22 g/mol. Its IUPAC name is 1-[4-(2,5-dioxopyrrol-1-yl)-3,3-difluorobutyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-(2,5-dioxopyrrol-1-yl)-3,3-difluorobutyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 167531667 |
| Molecular Formula | C12H10F2N2O4 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 1-[4-(2,5-dioxopyrrol-1-yl)-3,3-difluorobutyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCC(F)(F)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H10F2N2O4/c13-12(14,7-16-10(19)3-4-11(16)20)5-6-15-8(17)1-2-9(15)18/h1-4H,5-7H2 |
| InChIKey | XOMDUVJCRJFWOQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|